C31H34NO+ — CID 166053759
8-(4,4-diethylcyclohexyl)-3,20-dimethyl-12-oxa-3-azoniapentacyclo[11.7.1.02,11.05,10.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene (PubChem CID 166053759) has the molecular formula C31H34NO+ and a molecular weight of 436.62 g/mol. Its IUPAC name is 8-(4,4-diethylcyclohexyl)-3,20-dimethyl-12-oxa-3-azoniapentacyclo[11.7.1.02,11.05,10.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene.
| Compound Name | 8-(4,4-diethylcyclohexyl)-3,20-dimethyl-12-oxa-3-azoniapentacyclo[11.7.1.02,11.05,10.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene |
|---|---|
| PubChem CID | 166053759 |
| Molecular Formula | C31H34NO+ |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | 8-(4,4-diethylcyclohexyl)-3,20-dimethyl-12-oxa-3-azoniapentacyclo[11.7.1.02,11.05,10.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene |
| SMILES | CCC1(CC)CCC(c2ccc3c[n+](C)c4c(c3c2)Oc2cccc3ccc(C)c-4c23)CC1 |
| InChI | InChI=1S/C31H34NO/c1-5-31(6-2)16-14-21(15-17-31)23-12-13-24-19-32(4)29-27-20(3)10-11-22-8-7-9-26(28(22)27)33-30(29)25(24)18-23/h7-13,18-19,21H,5-6,14-17H2,1-4H3/q+1 |
| InChIKey | ZXNDNHCLRWLGKF-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|