C34H38NO+ — CID 164723527
6-(4,4-diethylcyclohexyl)-11,14-dimethyl-3-oxa-11-azoniahexacyclo[13.7.1.14,8.02,13.019,23.012,24]tetracosa-1,4(24),5,7,9,11,13,15,17,19(23)-decaene (PubChem CID 164723527) has the molecular formula C34H38NO+ and a molecular weight of 476.68 g/mol. Its IUPAC name is 6-(4,4-diethylcyclohexyl)-11,14-dimethyl-3-oxa-11-azoniahexacyclo[13.7.1.14,8.02,13.019,23.012,24]tetracosa-1,4(24),5,7,9,11,13,15,17,19(23)-decaene.
| Compound Name | 6-(4,4-diethylcyclohexyl)-11,14-dimethyl-3-oxa-11-azoniahexacyclo[13.7.1.14,8.02,13.019,23.012,24]tetracosa-1,4(24),5,7,9,11,13,15,17,19(23)-decaene |
|---|---|
| PubChem CID | 164723527 |
| Molecular Formula | C34H38NO+ |
| Molecular Weight | 476.68 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | 6-(4,4-diethylcyclohexyl)-11,14-dimethyl-3-oxa-11-azoniahexacyclo[13.7.1.14,8.02,13.019,23.012,24]tetracosa-1,4(24),5,7,9,11,13,15,17,19(23)-decaene |
| SMILES | CCC1(CC)CCC(c2cc3c4c([n+](C)ccc4c2)-c2c(c4c5c(cccc5c2C)CCC4)O3)CC1 |
| InChI | InChI=1S/C34H38NO/c1-5-34(6-2)16-13-22(14-17-34)25-19-24-15-18-35(4)32-29-21(3)26-11-7-9-23-10-8-12-27(30(23)26)33(29)36-28(20-25)31(24)32/h7,9,11,15,18-20,22H,5-6,8,10,12-14,16-17H2,1-4H3/q+1 |
| InChIKey | MJPNPAABARJXPP-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.68 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|