C28H30NOS+ — CID 164722339
14-(4,4-dimethylcyclohexyl)-3,9,19-trimethyl-11-oxa-7-thia-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),3,5,8,12(20),13,15,17-nonaene (PubChem CID 164722339) has the molecular formula C28H30NOS+ and a molecular weight of 428.62 g/mol. Its IUPAC name is 14-(4,4-dimethylcyclohexyl)-3,9,19-trimethyl-11-oxa-7-thia-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),3,5,8,12(20),13,15,17-nonaene.
| Compound Name | 14-(4,4-dimethylcyclohexyl)-3,9,19-trimethyl-11-oxa-7-thia-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),3,5,8,12(20),13,15,17-nonaene |
|---|---|
| PubChem CID | 164722339 |
| Molecular Formula | C28H30NOS+ |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 14-(4,4-dimethylcyclohexyl)-3,9,19-trimethyl-11-oxa-7-thia-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),3,5,8,12(20),13,15,17-nonaene |
| SMILES | Cc1c2c(c(C)c3sccc13)Oc1cc(C3CCC(C)(C)CC3)cc3cc[n+](C)c-2c13 |
| InChI | InChI=1S/C28H30NOS/c1-16-21-9-13-31-27(21)17(2)26-23(16)25-24-19(8-12-29(25)5)14-20(15-22(24)30-26)18-6-10-28(3,4)11-7-18/h8-9,12-15,18H,6-7,10-11H2,1-5H3/q+1 |
| InChIKey | XEMXHQBUGRCOGD-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|