C27H28NOS+ — CID 164722986
14-(4,4-dimethylcyclohexyl)-3,19-dimethyl-11-oxa-5-thia-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),3,6,8,12(20),13,15,17-nonaene (PubChem CID 164722986) has the molecular formula C27H28NOS+ and a molecular weight of 414.59 g/mol. Its IUPAC name is 14-(4,4-dimethylcyclohexyl)-3,19-dimethyl-11-oxa-5-thia-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),3,6,8,12(20),13,15,17-nonaene.
| Compound Name | 14-(4,4-dimethylcyclohexyl)-3,19-dimethyl-11-oxa-5-thia-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),3,6,8,12(20),13,15,17-nonaene |
|---|---|
| PubChem CID | 164722986 |
| Molecular Formula | C27H28NOS+ |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 14-(4,4-dimethylcyclohexyl)-3,19-dimethyl-11-oxa-5-thia-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),3,6,8,12(20),13,15,17-nonaene |
| SMILES | Cc1c2c(cc3ccsc13)Oc1cc(C3CCC(C)(C)CC3)cc3cc[n+](C)c-2c13 |
| InChI | InChI=1S/C27H28NOS/c1-16-23-21(14-19-8-12-30-26(16)19)29-22-15-20(17-5-9-27(2,3)10-6-17)13-18-7-11-28(4)25(23)24(18)22/h7-8,11-15,17H,5-6,9-10H2,1-4H3/q+1 |
| InChIKey | MNBBQBWUDGKPBD-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|