C25H24NOS+ — CID 164722248
14-(cyclopentylmethyl)-3,19-dimethyl-11-oxa-7-thia-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2,4(8),5,9,12(20),13,15,17-nonaene (PubChem CID 164722248) has the molecular formula C25H24NOS+ and a molecular weight of 386.54 g/mol. Its IUPAC name is 14-(cyclopentylmethyl)-3,19-dimethyl-11-oxa-7-thia-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2,4(8),5,9,12(20),13,15,17-nonaene.
| Compound Name | 14-(cyclopentylmethyl)-3,19-dimethyl-11-oxa-7-thia-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2,4(8),5,9,12(20),13,15,17-nonaene |
|---|---|
| PubChem CID | 164722248 |
| Molecular Formula | C25H24NOS+ |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 14-(cyclopentylmethyl)-3,19-dimethyl-11-oxa-7-thia-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2,4(8),5,9,12(20),13,15,17-nonaene |
| SMILES | Cc1c2c(cc3sccc13)Oc1cc(CC3CCCC3)cc3cc[n+](C)c-2c13 |
| InChI | InChI=1S/C25H24NOS/c1-15-19-8-10-28-22(19)14-21-23(15)25-24-18(7-9-26(25)2)12-17(13-20(24)27-21)11-16-5-3-4-6-16/h7-10,12-14,16H,3-6,11H2,1-2H3/q+1 |
| InChIKey | BWHGDFGBDRTSHV-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|