C37H46NO+ — CID 164723037
6-(cyclopentylmethyl)-10,15-bis(2,2-dimethylpropyl)-3,20-dimethyl-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2(11),3,5,7,9,13(21),14,16,18-decaene (PubChem CID 164723037) has the molecular formula C37H46NO+ and a molecular weight of 520.78 g/mol. Its IUPAC name is 6-(cyclopentylmethyl)-10,15-bis(2,2-dimethylpropyl)-3,20-dimethyl-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2(11),3,5,7,9,13(21),14,16,18-decaene.
| Compound Name | 6-(cyclopentylmethyl)-10,15-bis(2,2-dimethylpropyl)-3,20-dimethyl-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2(11),3,5,7,9,13(21),14,16,18-decaene |
|---|---|
| PubChem CID | 164723037 |
| Molecular Formula | C37H46NO+ |
| Molecular Weight | 520.78 g/mol |
| Exact Mass | 520.36 |
| IUPAC Name | 6-(cyclopentylmethyl)-10,15-bis(2,2-dimethylpropyl)-3,20-dimethyl-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2(11),3,5,7,9,13(21),14,16,18-decaene |
| SMILES | Cc1c2c(c(CC(C)(C)C)c3ccc(CC4CCCC4)cc13)Oc1cc(CC(C)(C)C)cc3cc[n+](C)c-2c13 |
| InChI | InChI=1S/C37H46NO/c1-23-29-19-25(17-24-11-9-10-12-24)13-14-28(29)30(22-37(5,6)7)35-32(23)34-33-27(15-16-38(34)8)18-26(20-31(33)39-35)21-36(2,3)4/h13-16,18-20,24H,9-12,17,21-22H2,1-8H3/q+1 |
| InChIKey | JOTABEXQMVNTOW-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.78 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|