C39H47N2O+ — CID 168732014
6,10,18-tris(2,2-dimethylpropyl)-3,24-dimethyl-12-oxa-16-aza-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14,16,18,20,22-dodecaene (PubChem CID 168732014) has the molecular formula C39H47N2O+ and a molecular weight of 559.82 g/mol. Its IUPAC name is 6,10,18-tris(2,2-dimethylpropyl)-3,24-dimethyl-12-oxa-16-aza-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14,16,18,20,22-dodecaene.
| Compound Name | 6,10,18-tris(2,2-dimethylpropyl)-3,24-dimethyl-12-oxa-16-aza-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14,16,18,20,22-dodecaene |
|---|---|
| PubChem CID | 168732014 |
| Molecular Formula | C39H47N2O+ |
| Molecular Weight | 559.82 g/mol |
| Exact Mass | 559.37 |
| IUPAC Name | 6,10,18-tris(2,2-dimethylpropyl)-3,24-dimethyl-12-oxa-16-aza-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14,16,18,20,22-dodecaene |
| SMILES | Cc1c2c(c(CC(C)(C)C)c3ccc(CC(C)(C)C)cc13)Oc1cc3ncc(CC(C)(C)C)cc3c3cc[n+](C)c-2c13 |
| InChI | InChI=1S/C39H47N2O/c1-23-28-16-24(19-37(2,3)4)12-13-26(28)30(21-39(8,9)10)36-33(23)35-34-27(14-15-41(35)11)29-17-25(20-38(5,6)7)22-40-31(29)18-32(34)42-36/h12-18,22H,19-21H2,1-11H3/q+1 |
| InChIKey | DWTWMJMRUMEWMT-UHFFFAOYSA-N |
| XLogP | 10.21 |
| TPSA | 26.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.82 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|