C38H46GeNO+ — CID 168733543
[6,10-bis(2,2-dimethylpropyl)-3,24-dimethyl-12-oxa-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14,16,18,20,22-dodecaen-19-yl]-trimethylgermane (PubChem CID 168733543) has the molecular formula C38H46GeNO+ and a molecular weight of 605.40 g/mol. Its IUPAC name is [6,10-bis(2,2-dimethylpropyl)-3,24-dimethyl-12-oxa-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14,16,18,20,22-dodecaen-19-yl]-trimethylgermane.
| Compound Name | [6,10-bis(2,2-dimethylpropyl)-3,24-dimethyl-12-oxa-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14,16,18,20,22-dodecaen-19-yl]-trimethylgermane |
|---|---|
| PubChem CID | 168733543 |
| Molecular Formula | C38H46GeNO+ |
| Molecular Weight | 605.40 g/mol |
| Exact Mass | 606.28 |
| IUPAC Name | [6,10-bis(2,2-dimethylpropyl)-3,24-dimethyl-12-oxa-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14,16,18,20,22-dodecaen-19-yl]-trimethylgermane |
| SMILES | Cc1c2c(c(CC(C)(C)C)c3ccc(CC(C)(C)C)cc13)Oc1cc3cccc([Ge](C)(C)C)c3c3cc[n+](C)c-2c13 |
| InChI | InChI=1S/C38H46GeNO/c1-23-28-19-24(21-37(2,3)4)15-16-26(28)29(22-38(5,6)7)36-32(23)35-34-27(17-18-40(35)11)33-25(20-31(34)41-36)13-12-14-30(33)39(8,9)10/h12-20H,21-22H2,1-11H3/q+1 |
| InChIKey | YZHXLAATQIPRHJ-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.40 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|