C40H40NO+ — CID 168733491
6-(2,2-dimethylpropyl)-3,24-dimethyl-10-(2-methylpropyl)-19-phenyl-12-oxa-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14,16,18,20,22-dodecaene (PubChem CID 168733491) has the molecular formula C40H40NO+ and a molecular weight of 550.77 g/mol. Its IUPAC name is 6-(2,2-dimethylpropyl)-3,24-dimethyl-10-(2-methylpropyl)-19-phenyl-12-oxa-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14,16,18,20,22-dodecaene.
| Compound Name | 6-(2,2-dimethylpropyl)-3,24-dimethyl-10-(2-methylpropyl)-19-phenyl-12-oxa-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14,16,18,20,22-dodecaene |
|---|---|
| PubChem CID | 168733491 |
| Molecular Formula | C40H40NO+ |
| Molecular Weight | 550.77 g/mol |
| Exact Mass | 550.31 |
| IUPAC Name | 6-(2,2-dimethylpropyl)-3,24-dimethyl-10-(2-methylpropyl)-19-phenyl-12-oxa-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14,16,18,20,22-dodecaene |
| SMILES | Cc1c2c(c(CC(C)C)c3ccc(CC(C)(C)C)cc13)Oc1cc3cccc(-c4ccccc4)c3c3cc[n+](C)c-2c13 |
| InChI | InChI=1S/C40H40NO/c1-24(2)20-33-30-17-16-26(23-40(4,5)6)21-32(30)25(3)35-38-37-31(18-19-41(38)7)36-28(22-34(37)42-39(33)35)14-11-15-29(36)27-12-9-8-10-13-27/h8-19,21-22,24H,20,23H2,1-7H3/q+1 |
| InChIKey | YRSIYGDSKBLEPA-UHFFFAOYSA-N |
| XLogP | 10.51 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.77 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|