C37H42NO+ — CID 168733002
10-(2,2-dimethylpropyl)-3,24-dimethyl-6-(2-methylpropyl)-18-propan-2-yl-12-oxa-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14,16,18,20,22-dodecaene (PubChem CID 168733002) has the molecular formula C37H42NO+ and a molecular weight of 516.75 g/mol. Its IUPAC name is 10-(2,2-dimethylpropyl)-3,24-dimethyl-6-(2-methylpropyl)-18-propan-2-yl-12-oxa-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14,16,18,20,22-dodecaene.
| Compound Name | 10-(2,2-dimethylpropyl)-3,24-dimethyl-6-(2-methylpropyl)-18-propan-2-yl-12-oxa-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14,16,18,20,22-dodecaene |
|---|---|
| PubChem CID | 168733002 |
| Molecular Formula | C37H42NO+ |
| Molecular Weight | 516.75 g/mol |
| Exact Mass | 516.33 |
| IUPAC Name | 10-(2,2-dimethylpropyl)-3,24-dimethyl-6-(2-methylpropyl)-18-propan-2-yl-12-oxa-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14,16,18,20,22-dodecaene |
| SMILES | Cc1c2c(c(CC(C)(C)C)c3ccc(CC(C)C)cc13)Oc1cc3ccc(C(C)C)cc3c3cc[n+](C)c-2c13 |
| InChI | InChI=1S/C37H42NO/c1-21(2)16-24-10-13-27-29(17-24)23(5)33-35-34-28(14-15-38(35)9)30-18-25(22(3)4)11-12-26(30)19-32(34)39-36(33)31(27)20-37(6,7)8/h10-15,17-19,21-22H,16,20H2,1-9H3/q+1 |
| InChIKey | CKXCDJPBIQJLLJ-UHFFFAOYSA-N |
| XLogP | 9.96 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.75 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|