C36H40NO+ — CID 168732978
6,10-bis(2,2-dimethylpropyl)-3,19,24-trimethyl-12-oxa-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13,15,17,19,21(25),22-dodecaene (PubChem CID 168732978) has the molecular formula C36H40NO+ and a molecular weight of 502.72 g/mol. Its IUPAC name is 6,10-bis(2,2-dimethylpropyl)-3,19,24-trimethyl-12-oxa-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13,15,17,19,21(25),22-dodecaene.
| Compound Name | 6,10-bis(2,2-dimethylpropyl)-3,19,24-trimethyl-12-oxa-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13,15,17,19,21(25),22-dodecaene |
|---|---|
| PubChem CID | 168732978 |
| Molecular Formula | C36H40NO+ |
| Molecular Weight | 502.72 g/mol |
| Exact Mass | 502.31 |
| IUPAC Name | 6,10-bis(2,2-dimethylpropyl)-3,19,24-trimethyl-12-oxa-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13,15,17,19,21(25),22-dodecaene |
| SMILES | Cc1c2c(c(CC(C)(C)C)c3ccc(CC(C)(C)C)cc13)Oc1cc3cccc(C)c3c3cc[n+](C)c-2c13 |
| InChI | InChI=1S/C36H40NO/c1-21-11-10-12-24-18-29-32-26(30(21)24)15-16-37(9)33(32)31-22(2)27-17-23(19-35(3,4)5)13-14-25(27)28(34(31)38-29)20-36(6,7)8/h10-18H,19-20H2,1-9H3/q+1 |
| InChIKey | NZCVYNZYIYNMBO-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.72 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|