C41H50NO+ — CID 168733405
6,10,16-tris(2,2-dimethylpropyl)-3,14,24-trimethyl-12-oxa-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13,15,17,19,21(25),22-dodecaene (PubChem CID 168733405) has the molecular formula C41H50NO+ and a molecular weight of 572.86 g/mol. Its IUPAC name is 6,10,16-tris(2,2-dimethylpropyl)-3,14,24-trimethyl-12-oxa-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13,15,17,19,21(25),22-dodecaene.
| Compound Name | 6,10,16-tris(2,2-dimethylpropyl)-3,14,24-trimethyl-12-oxa-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13,15,17,19,21(25),22-dodecaene |
|---|---|
| PubChem CID | 168733405 |
| Molecular Formula | C41H50NO+ |
| Molecular Weight | 572.86 g/mol |
| Exact Mass | 572.39 |
| IUPAC Name | 6,10,16-tris(2,2-dimethylpropyl)-3,14,24-trimethyl-12-oxa-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13,15,17,19,21(25),22-dodecaene |
| SMILES | Cc1c2c(c(CC(C)(C)C)c3ccc(CC(C)(C)C)cc13)Oc1c(C)c3c(CC(C)(C)C)cccc3c3cc[n+](C)c-2c13 |
| InChI | InChI=1S/C41H50NO/c1-24-31-20-26(21-39(3,4)5)16-17-28(31)32(23-41(9,10)11)38-34(24)36-35-30(18-19-42(36)12)29-15-13-14-27(22-40(6,7)8)33(29)25(2)37(35)43-38/h13-20H,21-23H2,1-12H3/q+1 |
| InChIKey | PTBBHGDRQKVHTL-UHFFFAOYSA-N |
| XLogP | 11.13 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.86 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|