C31H36NO+ — CID 164722233
15-(2,2-dimethylpropyl)-3,10,20-trimethyl-6-(2-methylpropyl)-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2(11),3,5,7,9,13(21),14,16,18-decaene (PubChem CID 164722233) has the molecular formula C31H36NO+ and a molecular weight of 438.64 g/mol. Its IUPAC name is 15-(2,2-dimethylpropyl)-3,10,20-trimethyl-6-(2-methylpropyl)-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2(11),3,5,7,9,13(21),14,16,18-decaene.
| Compound Name | 15-(2,2-dimethylpropyl)-3,10,20-trimethyl-6-(2-methylpropyl)-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2(11),3,5,7,9,13(21),14,16,18-decaene |
|---|---|
| PubChem CID | 164722233 |
| Molecular Formula | C31H36NO+ |
| Molecular Weight | 438.64 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | 15-(2,2-dimethylpropyl)-3,10,20-trimethyl-6-(2-methylpropyl)-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2(11),3,5,7,9,13(21),14,16,18-decaene |
| SMILES | Cc1c2c(c(C)c3cc(CC(C)C)ccc13)-c1c3c(cc(CC(C)(C)C)cc3cc[n+]1C)O2 |
| InChI | InChI=1S/C31H36NO/c1-18(2)13-21-9-10-24-20(4)30-27(19(3)25(24)15-21)29-28-23(11-12-32(29)8)14-22(16-26(28)33-30)17-31(5,6)7/h9-12,14-16,18H,13,17H2,1-8H3/q+1 |
| InChIKey | RKWCMRCTYYLQBN-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.64 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|