C28H32NOSi+ — CID 164722400
[3,20-dimethyl-15-(2-methylpropyl)-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaen-10-yl]-trimethylsilane (PubChem CID 164722400) has the molecular formula C28H32NOSi+ and a molecular weight of 426.66 g/mol. Its IUPAC name is [3,20-dimethyl-15-(2-methylpropyl)-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaen-10-yl]-trimethylsilane.
| Compound Name | [3,20-dimethyl-15-(2-methylpropyl)-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaen-10-yl]-trimethylsilane |
|---|---|
| PubChem CID | 164722400 |
| Molecular Formula | C28H32NOSi+ |
| Molecular Weight | 426.66 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | [3,20-dimethyl-15-(2-methylpropyl)-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaen-10-yl]-trimethylsilane |
| SMILES | Cc1c2c(c([Si](C)(C)C)c3ccccc13)Oc1cc(CC(C)C)cc3cc[n+](C)c-2c13 |
| InChI | InChI=1S/C28H32NOSi/c1-17(2)14-19-15-20-12-13-29(4)26-24-18(3)21-10-8-9-11-22(21)28(31(5,6)7)27(24)30-23(16-19)25(20)26/h8-13,15-17H,14H2,1-7H3/q+1 |
| InChIKey | PKQXKWHYMSZVEL-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.66 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|