C30H34NO+ — CID 166496801
18,19-dideuterio-10-(2,2-dimethylpropyl)-3,20-dimethyl-15-(2-methylpropyl)-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaene (PubChem CID 166496801) has the molecular formula C30H34NO+ and a molecular weight of 426.62 g/mol. Its IUPAC name is 18,19-dideuterio-10-(2,2-dimethylpropyl)-3,20-dimethyl-15-(2-methylpropyl)-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaene.
| Compound Name | 18,19-dideuterio-10-(2,2-dimethylpropyl)-3,20-dimethyl-15-(2-methylpropyl)-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaene |
|---|---|
| PubChem CID | 166496801 |
| Molecular Formula | C30H34NO+ |
| Molecular Weight | 426.62 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | 18,19-dideuterio-10-(2,2-dimethylpropyl)-3,20-dimethyl-15-(2-methylpropyl)-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaene |
| SMILES | [2H]c1c([2H])[n+](C)c2c3c(cc(CC(C)C)cc13)Oc1c-2c(C)c2ccccc2c1CC(C)(C)C |
| InChI | InChI=1S/C30H34NO/c1-18(2)14-20-15-21-12-13-31(7)28-26-19(3)22-10-8-9-11-23(22)24(17-30(4,5)6)29(26)32-25(16-20)27(21)28/h8-13,15-16,18H,14,17H2,1-7H3/q+1/i12D,13D |
| InChIKey | PWULUDAVOWTRGD-LNBFZYQFSA-N |
| XLogP | 7.69 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.62 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|