C33H35N2O+ — CID 168732982
10-(2,2-dimethylpropyl)-3,24-dimethyl-16-(2-methylpropyl)-12-oxa-22-aza-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2,4,6,8,10,13,15,17,19,21(25),22-dodecaene (PubChem CID 168732982) has the molecular formula C33H35N2O+ and a molecular weight of 475.66 g/mol. Its IUPAC name is 10-(2,2-dimethylpropyl)-3,24-dimethyl-16-(2-methylpropyl)-12-oxa-22-aza-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2,4,6,8,10,13,15,17,19,21(25),22-dodecaene.
| Compound Name | 10-(2,2-dimethylpropyl)-3,24-dimethyl-16-(2-methylpropyl)-12-oxa-22-aza-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2,4,6,8,10,13,15,17,19,21(25),22-dodecaene |
|---|---|
| PubChem CID | 168732982 |
| Molecular Formula | C33H35N2O+ |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | 10-(2,2-dimethylpropyl)-3,24-dimethyl-16-(2-methylpropyl)-12-oxa-22-aza-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2,4,6,8,10,13,15,17,19,21(25),22-dodecaene |
| SMILES | Cc1c2c(c(CC(C)(C)C)c3ccccc13)Oc1cc3c(CC(C)C)cccc3c3nc[n+](C)c-2c13 |
| InChI | InChI=1S/C33H35N2O/c1-19(2)15-21-11-10-14-24-25(21)16-27-29-30(24)34-18-35(7)31(29)28-20(3)22-12-8-9-13-23(22)26(32(28)36-27)17-33(4,5)6/h8-14,16,18-19H,15,17H2,1-7H3/q+1 |
| InChIKey | DMKRAAXFSLAAEX-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 26.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|