C33H36NOS+ — CID 164722487
10,16-bis(2,2-dimethylpropyl)-3,23-dimethyl-12-oxa-18-thia-23-azoniahexacyclo[11.10.1.02,11.04,9.015,19.020,24]tetracosa-1(23),2,4,6,8,10,13(24),14,16,19,21-undecaene (PubChem CID 164722487) has the molecular formula C33H36NOS+ and a molecular weight of 494.72 g/mol. Its IUPAC name is 10,16-bis(2,2-dimethylpropyl)-3,23-dimethyl-12-oxa-18-thia-23-azoniahexacyclo[11.10.1.02,11.04,9.015,19.020,24]tetracosa-1(23),2,4,6,8,10,13(24),14,16,19,21-undecaene.
| Compound Name | 10,16-bis(2,2-dimethylpropyl)-3,23-dimethyl-12-oxa-18-thia-23-azoniahexacyclo[11.10.1.02,11.04,9.015,19.020,24]tetracosa-1(23),2,4,6,8,10,13(24),14,16,19,21-undecaene |
|---|---|
| PubChem CID | 164722487 |
| Molecular Formula | C33H36NOS+ |
| Molecular Weight | 494.72 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | 10,16-bis(2,2-dimethylpropyl)-3,23-dimethyl-12-oxa-18-thia-23-azoniahexacyclo[11.10.1.02,11.04,9.015,19.020,24]tetracosa-1(23),2,4,6,8,10,13(24),14,16,19,21-undecaene |
| SMILES | Cc1c2c(c(CC(C)(C)C)c3ccccc13)Oc1cc3c(CC(C)(C)C)csc3c3cc[n+](C)c-2c13 |
| InChI | InChI=1S/C33H36NOS/c1-19-21-11-9-10-12-22(21)25(17-33(5,6)7)30-27(19)29-28-23(13-14-34(29)8)31-24(15-26(28)35-30)20(18-36-31)16-32(2,3)4/h9-15,18H,16-17H2,1-8H3/q+1 |
| InChIKey | UHHPRKABNWNRCL-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.72 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|