C33H30NO2+ — CID 170655189
25-(2,2-dimethylpropyl)-13,15,18-trimethyl-10,27-dioxa-15-azoniaheptacyclo[14.11.1.03,11.04,9.012,28.017,26.019,24]octacosa-1(28),2,4,6,8,11,13,15,17,19,21,23,25-tridecaene (PubChem CID 170655189) has the molecular formula C33H30NO2+ and a molecular weight of 472.61 g/mol. Its IUPAC name is 25-(2,2-dimethylpropyl)-13,15,18-trimethyl-10,27-dioxa-15-azoniaheptacyclo[14.11.1.03,11.04,9.012,28.017,26.019,24]octacosa-1(28),2,4,6,8,11,13,15,17,19,21,23,25-tridecaene.
| Compound Name | 25-(2,2-dimethylpropyl)-13,15,18-trimethyl-10,27-dioxa-15-azoniaheptacyclo[14.11.1.03,11.04,9.012,28.017,26.019,24]octacosa-1(28),2,4,6,8,11,13,15,17,19,21,23,25-tridecaene |
|---|---|
| PubChem CID | 170655189 |
| Molecular Formula | C33H30NO2+ |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | 25-(2,2-dimethylpropyl)-13,15,18-trimethyl-10,27-dioxa-15-azoniaheptacyclo[14.11.1.03,11.04,9.012,28.017,26.019,24]octacosa-1(28),2,4,6,8,11,13,15,17,19,21,23,25-tridecaene |
| SMILES | Cc1c2c(c(CC(C)(C)C)c3ccccc13)Oc1cc3c4ccccc4oc3c3c(C)c[n+](C)c-2c13 |
| InChI | InChI=1S/C33H30NO2/c1-18-17-34(6)30-28-19(2)20-11-7-8-12-21(20)24(16-33(3,4)5)32(28)36-26-15-23-22-13-9-10-14-25(22)35-31(23)27(18)29(26)30/h7-15,17H,16H2,1-6H3/q+1 |
| InChIKey | VXCNBJREEVJXNP-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 26.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|