C30H26NO3+ — CID 170655204
24-(2,2-dimethylpropyl)-15,18-dimethyl-10,20,26-trioxa-15-azoniaheptacyclo[14.10.1.03,11.04,9.012,27.017,25.019,23]heptacosa-1(27),2,4,6,8,11,13,15,17,19(23),21,24-dodecaene (PubChem CID 170655204) has the molecular formula C30H26NO3+ and a molecular weight of 448.54 g/mol. Its IUPAC name is 24-(2,2-dimethylpropyl)-15,18-dimethyl-10,20,26-trioxa-15-azoniaheptacyclo[14.10.1.03,11.04,9.012,27.017,25.019,23]heptacosa-1(27),2,4,6,8,11,13,15,17,19(23),21,24-dodecaene.
| Compound Name | 24-(2,2-dimethylpropyl)-15,18-dimethyl-10,20,26-trioxa-15-azoniaheptacyclo[14.10.1.03,11.04,9.012,27.017,25.019,23]heptacosa-1(27),2,4,6,8,11,13,15,17,19(23),21,24-dodecaene |
|---|---|
| PubChem CID | 170655204 |
| Molecular Formula | C30H26NO3+ |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 24-(2,2-dimethylpropyl)-15,18-dimethyl-10,20,26-trioxa-15-azoniaheptacyclo[14.10.1.03,11.04,9.012,27.017,25.019,23]heptacosa-1(27),2,4,6,8,11,13,15,17,19(23),21,24-dodecaene |
| SMILES | Cc1c2c(c(CC(C)(C)C)c3ccoc13)Oc1cc3c4ccccc4oc3c3cc[n+](C)c-2c13 |
| InChI | InChI=1S/C30H26NO3/c1-16-24-26-25-19(10-12-31(26)5)28-20(17-8-6-7-9-22(17)33-28)14-23(25)34-29(24)21(15-30(2,3)4)18-11-13-32-27(16)18/h6-14H,15H2,1-5H3/q+1 |
| InChIKey | VQDRVAHGZQZVHU-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|