C33H36NOS+ — CID 168732567
5,21-bis(2,2-dimethylpropyl)-12,15-dimethyl-23-oxa-17-thia-12-azoniahexacyclo[11.10.1.03,8.09,24.014,22.016,20]tetracosa-1(24),2,4,6,8,10,12,14,16(20),18,21-undecaene (PubChem CID 168732567) has the molecular formula C33H36NOS+ and a molecular weight of 494.72 g/mol. Its IUPAC name is 5,21-bis(2,2-dimethylpropyl)-12,15-dimethyl-23-oxa-17-thia-12-azoniahexacyclo[11.10.1.03,8.09,24.014,22.016,20]tetracosa-1(24),2,4,6,8,10,12,14,16(20),18,21-undecaene.
| Compound Name | 5,21-bis(2,2-dimethylpropyl)-12,15-dimethyl-23-oxa-17-thia-12-azoniahexacyclo[11.10.1.03,8.09,24.014,22.016,20]tetracosa-1(24),2,4,6,8,10,12,14,16(20),18,21-undecaene |
|---|---|
| PubChem CID | 168732567 |
| Molecular Formula | C33H36NOS+ |
| Molecular Weight | 494.72 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | 5,21-bis(2,2-dimethylpropyl)-12,15-dimethyl-23-oxa-17-thia-12-azoniahexacyclo[11.10.1.03,8.09,24.014,22.016,20]tetracosa-1(24),2,4,6,8,10,12,14,16(20),18,21-undecaene |
| SMILES | Cc1c2c(c(CC(C)(C)C)c3ccsc13)Oc1cc3cc(CC(C)(C)C)ccc3c3cc[n+](C)c-2c13 |
| InChI | InChI=1S/C33H36NOS/c1-19-27-29-28-23(11-13-34(29)8)22-10-9-20(17-32(2,3)4)15-21(22)16-26(28)35-30(27)25(18-33(5,6)7)24-12-14-36-31(19)24/h9-16H,17-18H2,1-8H3/q+1 |
| InChIKey | POXZLJTYGPTFQK-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.72 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|