C26H27N2O+ — CID 166054513
10-(2,2-dimethylpropyl)-3,6,20-trimethyl-12-oxa-18-aza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2(11),3,5,7,9,13,15,17(21),18-decaene (PubChem CID 166054513) has the molecular formula C26H27N2O+ and a molecular weight of 383.52 g/mol. Its IUPAC name is 10-(2,2-dimethylpropyl)-3,6,20-trimethyl-12-oxa-18-aza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2(11),3,5,7,9,13,15,17(21),18-decaene.
| Compound Name | 10-(2,2-dimethylpropyl)-3,6,20-trimethyl-12-oxa-18-aza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2(11),3,5,7,9,13,15,17(21),18-decaene |
|---|---|
| PubChem CID | 166054513 |
| Molecular Formula | C26H27N2O+ |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 10-(2,2-dimethylpropyl)-3,6,20-trimethyl-12-oxa-18-aza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2(11),3,5,7,9,13,15,17(21),18-decaene |
| SMILES | Cc1ccc2c(CC(C)(C)C)c3c(c(C)c2c1)-c1c2c(cccc2nc[n+]1C)O3 |
| InChI | InChI=1S/C26H27N2O/c1-15-10-11-17-18(12-15)16(2)22-24-23-20(27-14-28(24)6)8-7-9-21(23)29-25(22)19(17)13-26(3,4)5/h7-12,14H,13H2,1-6H3/q+1 |
| InChIKey | ZXFNISXPLXHFEL-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 26.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|