C39H44NO+ — CID 168732813
16-(4,4-dimethylcyclohexyl)-10-(2,2-dimethylpropyl)-3,6,24-trimethyl-12-oxa-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14,16,18,20,22-dodecaene (PubChem CID 168732813) has the molecular formula C39H44NO+ and a molecular weight of 542.79 g/mol. Its IUPAC name is 16-(4,4-dimethylcyclohexyl)-10-(2,2-dimethylpropyl)-3,6,24-trimethyl-12-oxa-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14,16,18,20,22-dodecaene.
| Compound Name | 16-(4,4-dimethylcyclohexyl)-10-(2,2-dimethylpropyl)-3,6,24-trimethyl-12-oxa-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14,16,18,20,22-dodecaene |
|---|---|
| PubChem CID | 168732813 |
| Molecular Formula | C39H44NO+ |
| Molecular Weight | 542.79 g/mol |
| Exact Mass | 542.34 |
| IUPAC Name | 16-(4,4-dimethylcyclohexyl)-10-(2,2-dimethylpropyl)-3,6,24-trimethyl-12-oxa-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14,16,18,20,22-dodecaene |
| SMILES | Cc1ccc2c(CC(C)(C)C)c3c(c(C)c2c1)-c1c2c(cc4c(C5CCC(C)(C)CC5)cccc4c2cc[n+]1C)O3 |
| InChI | InChI=1S/C39H44NO/c1-23-12-13-28-30(20-23)24(2)34-36-35-29(16-19-40(36)8)27-11-9-10-26(25-14-17-39(6,7)18-15-25)31(27)21-33(35)41-37(34)32(28)22-38(3,4)5/h9-13,16,19-21,25H,14-15,17-18,22H2,1-8H3/q+1 |
| InChIKey | GGLAANFUCCSLPK-UHFFFAOYSA-N |
| XLogP | 10.63 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.79 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|