C32H38NO+ — CID 164722533
19-deuterio-10,15-bis(2,2-dimethylpropyl)-3,6,20-trimethyl-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2(11),3,5,7,9,13(21),14,16,18-decaene (PubChem CID 164722533) has the molecular formula C32H38NO+ and a molecular weight of 453.67 g/mol. Its IUPAC name is 19-deuterio-10,15-bis(2,2-dimethylpropyl)-3,6,20-trimethyl-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2(11),3,5,7,9,13(21),14,16,18-decaene.
| Compound Name | 19-deuterio-10,15-bis(2,2-dimethylpropyl)-3,6,20-trimethyl-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2(11),3,5,7,9,13(21),14,16,18-decaene |
|---|---|
| PubChem CID | 164722533 |
| Molecular Formula | C32H38NO+ |
| Molecular Weight | 453.67 g/mol |
| Exact Mass | 453.30 |
| IUPAC Name | 19-deuterio-10,15-bis(2,2-dimethylpropyl)-3,6,20-trimethyl-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2(11),3,5,7,9,13(21),14,16,18-decaene |
| SMILES | [2H]c1cc2cc(CC(C)(C)C)cc3c2c([n+]1C)-c1c(c(CC(C)(C)C)c2ccc(C)cc2c1C)O3 |
| InChI | InChI=1S/C32H38NO/c1-19-10-11-23-24(14-19)20(2)27-29-28-22(12-13-33(29)9)15-21(17-31(3,4)5)16-26(28)34-30(27)25(23)18-32(6,7)8/h10-16H,17-18H2,1-9H3/q+1/i13D |
| InChIKey | VKCCOHSPFOJHBV-YSOHJTORSA-N |
| XLogP | 8.38 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.67 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|