C31H36NS+ — CID 166496790
19-deuterio-10,15-bis(2,2-dimethylpropyl)-3,20-dimethyl-12-thia-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaene (PubChem CID 166496790) has the molecular formula C31H36NS+ and a molecular weight of 455.71 g/mol. Its IUPAC name is 19-deuterio-10,15-bis(2,2-dimethylpropyl)-3,20-dimethyl-12-thia-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaene.
| Compound Name | 19-deuterio-10,15-bis(2,2-dimethylpropyl)-3,20-dimethyl-12-thia-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaene |
|---|---|
| PubChem CID | 166496790 |
| Molecular Formula | C31H36NS+ |
| Molecular Weight | 455.71 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | 19-deuterio-10,15-bis(2,2-dimethylpropyl)-3,20-dimethyl-12-thia-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaene |
| SMILES | [2H]c1cc2cc(CC(C)(C)C)cc3c2c([n+]1C)-c1c(c(CC(C)(C)C)c2ccccc2c1C)S3 |
| InChI | InChI=1S/C31H36NS/c1-19-22-11-9-10-12-23(22)24(18-31(5,6)7)29-26(19)28-27-21(13-14-32(28)8)15-20(16-25(27)33-29)17-30(2,3)4/h9-16H,17-18H2,1-8H3/q+1/i14D |
| InChIKey | UNIWQCBJIFMABS-FCFVPJCTSA-N |
| XLogP | 8.43 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.71 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|