C31H28NOS2+ — CID 170655336
24-(2,2-dimethylpropyl)-6,14,17-trimethyl-5-oxa-3,26-dithia-14-azoniaheptacyclo[13.11.1.02,9.04,8.011,27.016,25.018,23]heptacosa-1(27),2(9),4(8),6,10,12,14,16,18,20,22,24-dodecaene (PubChem CID 170655336) has the molecular formula C31H28NOS2+ and a molecular weight of 494.71 g/mol. Its IUPAC name is 24-(2,2-dimethylpropyl)-6,14,17-trimethyl-5-oxa-3,26-dithia-14-azoniaheptacyclo[13.11.1.02,9.04,8.011,27.016,25.018,23]heptacosa-1(27),2(9),4(8),6,10,12,14,16,18,20,22,24-dodecaene.
| Compound Name | 24-(2,2-dimethylpropyl)-6,14,17-trimethyl-5-oxa-3,26-dithia-14-azoniaheptacyclo[13.11.1.02,9.04,8.011,27.016,25.018,23]heptacosa-1(27),2(9),4(8),6,10,12,14,16,18,20,22,24-dodecaene |
|---|---|
| PubChem CID | 170655336 |
| Molecular Formula | C31H28NOS2+ |
| Molecular Weight | 494.71 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 24-(2,2-dimethylpropyl)-6,14,17-trimethyl-5-oxa-3,26-dithia-14-azoniaheptacyclo[13.11.1.02,9.04,8.011,27.016,25.018,23]heptacosa-1(27),2(9),4(8),6,10,12,14,16,18,20,22,24-dodecaene |
| SMILES | Cc1cc2c(o1)sc1c3c4c([n+](C)ccc4cc12)-c1c(c(CC(C)(C)C)c2ccccc2c1C)S3 |
| InChI | InChI=1S/C31H28NOS2/c1-16-13-22-21-14-18-11-12-32(6)26-24-17(2)19-9-7-8-10-20(19)23(15-31(3,4)5)27(24)34-29(25(18)26)28(21)35-30(22)33-16/h7-14H,15H2,1-6H3/q+1 |
| InChIKey | PZLITGKNVHGQIS-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.71 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|