C31H34NS3+ — CID 164723450
13,17-bis(2,2-dimethylpropyl)-3,22-dimethyl-5,15,18-trithia-22-azoniahexacyclo[14.6.1.02,14.04,12.06,11.019,23]tricosa-1(22),2,4(12),6,8,10,13,16,19(23),20-decaene (PubChem CID 164723450) has the molecular formula C31H34NS3+ and a molecular weight of 516.82 g/mol. Its IUPAC name is 13,17-bis(2,2-dimethylpropyl)-3,22-dimethyl-5,15,18-trithia-22-azoniahexacyclo[14.6.1.02,14.04,12.06,11.019,23]tricosa-1(22),2,4(12),6,8,10,13,16,19(23),20-decaene.
| Compound Name | 13,17-bis(2,2-dimethylpropyl)-3,22-dimethyl-5,15,18-trithia-22-azoniahexacyclo[14.6.1.02,14.04,12.06,11.019,23]tricosa-1(22),2,4(12),6,8,10,13,16,19(23),20-decaene |
|---|---|
| PubChem CID | 164723450 |
| Molecular Formula | C31H34NS3+ |
| Molecular Weight | 516.82 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | 13,17-bis(2,2-dimethylpropyl)-3,22-dimethyl-5,15,18-trithia-22-azoniahexacyclo[14.6.1.02,14.04,12.06,11.019,23]tricosa-1(22),2,4(12),6,8,10,13,16,19(23),20-decaene |
| SMILES | Cc1c2c(c(CC(C)(C)C)c3c1sc1ccccc13)Sc1c(CC(C)(C)C)sc3cc[n+](C)c-2c13 |
| InChI | InChI=1S/C31H34NS3/c1-17-23-26-25-21(13-14-32(26)8)33-22(16-31(5,6)7)29(25)35-28(23)19(15-30(2,3)4)24-18-11-9-10-12-20(18)34-27(17)24/h9-14H,15-16H2,1-8H3/q+1 |
| InChIKey | FRQYYWPTCWLAJL-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.82 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|