C38H40NS2+ — CID 170655257
6,25-bis(2,2-dimethylpropyl)-15,18,21-trimethyl-10,27-dithia-15-azoniaheptacyclo[14.11.1.03,11.04,9.012,28.017,26.019,24]octacosa-1(28),2,4(9),5,7,11,13,15,17(26),18,20,22,24-tridecaene (PubChem CID 170655257) has the molecular formula C38H40NS2+ and a molecular weight of 574.88 g/mol. Its IUPAC name is 6,25-bis(2,2-dimethylpropyl)-15,18,21-trimethyl-10,27-dithia-15-azoniaheptacyclo[14.11.1.03,11.04,9.012,28.017,26.019,24]octacosa-1(28),2,4(9),5,7,11,13,15,17(26),18,20,22,24-tridecaene.
| Compound Name | 6,25-bis(2,2-dimethylpropyl)-15,18,21-trimethyl-10,27-dithia-15-azoniaheptacyclo[14.11.1.03,11.04,9.012,28.017,26.019,24]octacosa-1(28),2,4(9),5,7,11,13,15,17(26),18,20,22,24-tridecaene |
|---|---|
| PubChem CID | 170655257 |
| Molecular Formula | C38H40NS2+ |
| Molecular Weight | 574.88 g/mol |
| Exact Mass | 574.26 |
| IUPAC Name | 6,25-bis(2,2-dimethylpropyl)-15,18,21-trimethyl-10,27-dithia-15-azoniaheptacyclo[14.11.1.03,11.04,9.012,28.017,26.019,24]octacosa-1(28),2,4(9),5,7,11,13,15,17(26),18,20,22,24-tridecaene |
| SMILES | Cc1ccc2c(CC(C)(C)C)c3c(c(C)c2c1)-c1c2c(cc4c5cc(CC(C)(C)C)ccc5sc4c2cc[n+]1C)S3 |
| InChI | InChI=1S/C38H40NS2/c1-21-10-12-24-26(16-21)22(2)32-34-33-25(14-15-39(34)9)35-28(18-31(33)41-36(32)29(24)20-38(6,7)8)27-17-23(19-37(3,4)5)11-13-30(27)40-35/h10-18H,19-20H2,1-9H3/q+1 |
| InChIKey | NYKRHIARSBKMOC-UHFFFAOYSA-N |
| XLogP | 11.11 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.88 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|