C34H44GeNS+ — CID 164722440
[19-deuterio-6,10-bis(2,2-dimethylpropyl)-3,20-dimethyl-12-thia-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2(11),3,5,7,9,13(21),14,16,18-decaen-15-yl]-trimethylgermane (PubChem CID 164722440) has the molecular formula C34H44GeNS+ and a molecular weight of 572.42 g/mol. Its IUPAC name is [19-deuterio-6,10-bis(2,2-dimethylpropyl)-3,20-dimethyl-12-thia-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2(11),3,5,7,9,13(21),14,16,18-decaen-15-yl]-trimethylgermane.
| Compound Name | [19-deuterio-6,10-bis(2,2-dimethylpropyl)-3,20-dimethyl-12-thia-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2(11),3,5,7,9,13(21),14,16,18-decaen-15-yl]-trimethylgermane |
|---|---|
| PubChem CID | 164722440 |
| Molecular Formula | C34H44GeNS+ |
| Molecular Weight | 572.42 g/mol |
| Exact Mass | 573.25 |
| IUPAC Name | [19-deuterio-6,10-bis(2,2-dimethylpropyl)-3,20-dimethyl-12-thia-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2(11),3,5,7,9,13(21),14,16,18-decaen-15-yl]-trimethylgermane |
| SMILES | [2H]c1cc2cc([Ge](C)(C)C)cc3c2c([n+]1C)-c1c(c(CC(C)(C)C)c2ccc(CC(C)(C)C)cc2c1C)S3 |
| InChI | InChI=1S/C34H44GeNS/c1-21-26-16-22(19-33(2,3)4)12-13-25(26)27(20-34(5,6)7)32-29(21)31-30-23(14-15-36(31)11)17-24(35(8,9)10)18-28(30)37-32/h12-18H,19-20H2,1-11H3/q+1/i15D |
| InChIKey | YIMQWDZEQMRUFZ-RWFJLFJASA-N |
| XLogP | 8.98 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.42 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|