C33H36NSSi+ — CID 168732214
[10-(2,2-dimethylpropyl)-3,24-dimethyl-12-thia-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2,4,6,8,10,13(25),14,16,18,20,22-dodecaen-17-yl]-trimethylsilane (PubChem CID 168732214) has the molecular formula C33H36NSSi+ and a molecular weight of 506.81 g/mol. Its IUPAC name is [10-(2,2-dimethylpropyl)-3,24-dimethyl-12-thia-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2,4,6,8,10,13(25),14,16,18,20,22-dodecaen-17-yl]-trimethylsilane.
| Compound Name | [10-(2,2-dimethylpropyl)-3,24-dimethyl-12-thia-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2,4,6,8,10,13(25),14,16,18,20,22-dodecaen-17-yl]-trimethylsilane |
|---|---|
| PubChem CID | 168732214 |
| Molecular Formula | C33H36NSSi+ |
| Molecular Weight | 506.81 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | [10-(2,2-dimethylpropyl)-3,24-dimethyl-12-thia-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2,4,6,8,10,13(25),14,16,18,20,22-dodecaen-17-yl]-trimethylsilane |
| SMILES | Cc1c2c(c(CC(C)(C)C)c3ccccc13)Sc1cc3cc([Si](C)(C)C)ccc3c3cc[n+](C)c-2c13 |
| InChI | InChI=1S/C33H36NSSi/c1-20-23-11-9-10-12-25(23)27(19-33(2,3)4)32-29(20)31-30-26(15-16-34(31)5)24-14-13-22(36(6,7)8)17-21(24)18-28(30)35-32/h9-18H,19H2,1-8H3/q+1 |
| InChIKey | QSQSQEMIBKJLGV-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.81 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|