C28H26NSSi+ — CID 168732482
(3,24-dimethyl-12-thia-24-azoniahexacyclo[11.11.1.02,11.04,9.014,19.021,25]pentacosa-1(24),2,4,6,8,10,13(25),14(19),15,17,20,22-dodecaen-17-yl)-trimethylsilane (PubChem CID 168732482) has the molecular formula C28H26NSSi+ and a molecular weight of 436.68 g/mol. Its IUPAC name is (3,24-dimethyl-12-thia-24-azoniahexacyclo[11.11.1.02,11.04,9.014,19.021,25]pentacosa-1(24),2,4,6,8,10,13(25),14(19),15,17,20,22-dodecaen-17-yl)-trimethylsilane.
| Compound Name | (3,24-dimethyl-12-thia-24-azoniahexacyclo[11.11.1.02,11.04,9.014,19.021,25]pentacosa-1(24),2,4,6,8,10,13(25),14(19),15,17,20,22-dodecaen-17-yl)-trimethylsilane |
|---|---|
| PubChem CID | 168732482 |
| Molecular Formula | C28H26NSSi+ |
| Molecular Weight | 436.68 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | (3,24-dimethyl-12-thia-24-azoniahexacyclo[11.11.1.02,11.04,9.014,19.021,25]pentacosa-1(24),2,4,6,8,10,13(25),14(19),15,17,20,22-dodecaen-17-yl)-trimethylsilane |
| SMILES | Cc1c2c(cc3ccccc13)Sc1c3ccc([Si](C)(C)C)cc3cc3cc[n+](C)c-2c13 |
| InChI | InChI=1S/C28H26NSSi/c1-17-22-9-7-6-8-18(22)16-24-25(17)27-26-19(12-13-29(27)2)14-20-15-21(31(3,4)5)10-11-23(20)28(26)30-24/h6-16H,1-5H3/q+1 |
| InChIKey | RGZMWWUKFGTALE-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.68 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|