C33H34NS+ — CID 168732845
3,24-dimethyl-10,19-bis(2-methylpropyl)-12-thia-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2,4,6,8,10,13(25),14,16,18,20,22-dodecaene (PubChem CID 168732845) has the molecular formula C33H34NS+ and a molecular weight of 476.71 g/mol. Its IUPAC name is 3,24-dimethyl-10,19-bis(2-methylpropyl)-12-thia-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2,4,6,8,10,13(25),14,16,18,20,22-dodecaene.
| Compound Name | 3,24-dimethyl-10,19-bis(2-methylpropyl)-12-thia-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2,4,6,8,10,13(25),14,16,18,20,22-dodecaene |
|---|---|
| PubChem CID | 168732845 |
| Molecular Formula | C33H34NS+ |
| Molecular Weight | 476.71 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | 3,24-dimethyl-10,19-bis(2-methylpropyl)-12-thia-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2,4,6,8,10,13(25),14,16,18,20,22-dodecaene |
| SMILES | Cc1c2c(c(CC(C)C)c3ccccc13)Sc1cc3cccc(CC(C)C)c3c3cc[n+](C)c-2c13 |
| InChI | InChI=1S/C33H34NS/c1-19(2)16-22-10-9-11-23-18-28-31-26(30(22)23)14-15-34(6)32(31)29-21(5)24-12-7-8-13-25(24)27(17-20(3)4)33(29)35-28/h7-15,18-20H,16-17H2,1-6H3/q+1 |
| InChIKey | DJQGYFVYMONXFB-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.71 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|