C31H32GeNS+ — CID 168732666
(3,24-dimethyl-10-propan-2-yl-12-thia-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2,4,6,8,10,13(25),14,16,18,20,22-dodecaen-17-yl)-trimethylgermane (PubChem CID 168732666) has the molecular formula C31H32GeNS+ and a molecular weight of 523.28 g/mol. Its IUPAC name is (3,24-dimethyl-10-propan-2-yl-12-thia-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2,4,6,8,10,13(25),14,16,18,20,22-dodecaen-17-yl)-trimethylgermane.
| Compound Name | (3,24-dimethyl-10-propan-2-yl-12-thia-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2,4,6,8,10,13(25),14,16,18,20,22-dodecaen-17-yl)-trimethylgermane |
|---|---|
| PubChem CID | 168732666 |
| Molecular Formula | C31H32GeNS+ |
| Molecular Weight | 523.28 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | (3,24-dimethyl-10-propan-2-yl-12-thia-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2,4,6,8,10,13(25),14,16,18,20,22-dodecaen-17-yl)-trimethylgermane |
| SMILES | Cc1c2c(c(C(C)C)c3ccccc13)Sc1cc3cc([Ge](C)(C)C)ccc3c3cc[n+](C)c-2c13 |
| InChI | InChI=1S/C31H32GeNS/c1-18(2)27-24-11-9-8-10-22(24)19(3)28-30-29-25(14-15-33(30)7)23-13-12-21(32(4,5)6)16-20(23)17-26(29)34-31(27)28/h8-18H,1-7H3/q+1 |
| InChIKey | DDWXVJQKWYDLTK-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.28 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|