C30H30GeNS+ — CID 168733791
trimethyl-(3,6,10,24-tetramethyl-12-thia-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14,16,18,20,22-dodecaen-17-yl)germane (PubChem CID 168733791) has the molecular formula C30H30GeNS+ and a molecular weight of 509.25 g/mol. Its IUPAC name is trimethyl-(3,6,10,24-tetramethyl-12-thia-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14,16,18,20,22-dodecaen-17-yl)germane.
| Compound Name | trimethyl-(3,6,10,24-tetramethyl-12-thia-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14,16,18,20,22-dodecaen-17-yl)germane |
|---|---|
| PubChem CID | 168733791 |
| Molecular Formula | C30H30GeNS+ |
| Molecular Weight | 509.25 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | trimethyl-(3,6,10,24-tetramethyl-12-thia-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14,16,18,20,22-dodecaen-17-yl)germane |
| SMILES | Cc1ccc2c(C)c3c(c(C)c2c1)-c1c2c(cc4cc([Ge](C)(C)C)ccc4c2cc[n+]1C)S3 |
| InChI | InChI=1S/C30H30GeNS/c1-17-8-10-22-19(3)30-27(18(2)25(22)14-17)29-28-24(12-13-32(29)7)23-11-9-21(31(4,5)6)15-20(23)16-26(28)33-30/h8-16H,1-7H3/q+1 |
| InChIKey | AHAJPMFFKRSUGB-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.25 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|