C37H38NOS+ — CID 168732957
13,20-bis(2,2-dimethylpropyl)-3,27-dimethyl-11-oxa-15-thia-27-azoniaheptacyclo[14.11.1.02,14.04,12.05,10.018,23.024,28]octacosa-1(27),2(14),3,5,7,9,12,16(28),17,19,21,23,25-tridecaene (PubChem CID 168732957) has the molecular formula C37H38NOS+ and a molecular weight of 544.78 g/mol. Its IUPAC name is 13,20-bis(2,2-dimethylpropyl)-3,27-dimethyl-11-oxa-15-thia-27-azoniaheptacyclo[14.11.1.02,14.04,12.05,10.018,23.024,28]octacosa-1(27),2(14),3,5,7,9,12,16(28),17,19,21,23,25-tridecaene.
| Compound Name | 13,20-bis(2,2-dimethylpropyl)-3,27-dimethyl-11-oxa-15-thia-27-azoniaheptacyclo[14.11.1.02,14.04,12.05,10.018,23.024,28]octacosa-1(27),2(14),3,5,7,9,12,16(28),17,19,21,23,25-tridecaene |
|---|---|
| PubChem CID | 168732957 |
| Molecular Formula | C37H38NOS+ |
| Molecular Weight | 544.78 g/mol |
| Exact Mass | 544.27 |
| IUPAC Name | 13,20-bis(2,2-dimethylpropyl)-3,27-dimethyl-11-oxa-15-thia-27-azoniaheptacyclo[14.11.1.02,14.04,12.05,10.018,23.024,28]octacosa-1(27),2(14),3,5,7,9,12,16(28),17,19,21,23,25-tridecaene |
| SMILES | Cc1c2c(c(CC(C)(C)C)c3oc4ccccc4c13)Sc1cc3cc(CC(C)(C)C)ccc3c3cc[n+](C)c-2c13 |
| InChI | InChI=1S/C37H38NOS/c1-21-30-26-11-9-10-12-28(26)39-34(30)27(20-37(5,6)7)35-31(21)33-32-25(15-16-38(33)8)24-14-13-22(19-36(2,3)4)17-23(24)18-29(32)40-35/h9-18H,19-20H2,1-8H3/q+1 |
| InChIKey | QWRAYHOZSKTEIW-UHFFFAOYSA-N |
| XLogP | 10.33 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.78 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|