C34H37N2S+ — CID 168732966
10,16-bis(2,2-dimethylpropyl)-3,24-dimethyl-12-thia-7-aza-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13,15,17,19,21(25),22-dodecaene (PubChem CID 168732966) has the molecular formula C34H37N2S+ and a molecular weight of 505.75 g/mol. Its IUPAC name is 10,16-bis(2,2-dimethylpropyl)-3,24-dimethyl-12-thia-7-aza-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13,15,17,19,21(25),22-dodecaene.
| Compound Name | 10,16-bis(2,2-dimethylpropyl)-3,24-dimethyl-12-thia-7-aza-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13,15,17,19,21(25),22-dodecaene |
|---|---|
| PubChem CID | 168732966 |
| Molecular Formula | C34H37N2S+ |
| Molecular Weight | 505.75 g/mol |
| Exact Mass | 505.27 |
| IUPAC Name | 10,16-bis(2,2-dimethylpropyl)-3,24-dimethyl-12-thia-7-aza-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13,15,17,19,21(25),22-dodecaene |
| SMILES | Cc1c2c(c(CC(C)(C)C)c3cnccc13)Sc1cc3c(CC(C)(C)C)cccc3c3cc[n+](C)c-2c13 |
| InChI | InChI=1S/C34H37N2S/c1-20-22-12-14-35-19-27(22)26(18-34(5,6)7)32-29(20)31-30-24(13-15-36(31)8)23-11-9-10-21(17-33(2,3)4)25(23)16-28(30)37-32/h9-16,19H,17-18H2,1-8H3/q+1 |
| InChIKey | UQTXLBQLHCBPLS-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.75 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|