C32H34NSSi+ — CID 168733407
(10-tert-butyl-3,24-dimethyl-12-thia-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2,4,6,8,10,13(25),14,16,18,20,22-dodecaen-16-yl)-trimethylsilane (PubChem CID 168733407) has the molecular formula C32H34NSSi+ and a molecular weight of 492.78 g/mol. Its IUPAC name is (10-tert-butyl-3,24-dimethyl-12-thia-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2,4,6,8,10,13(25),14,16,18,20,22-dodecaen-16-yl)-trimethylsilane.
| Compound Name | (10-tert-butyl-3,24-dimethyl-12-thia-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2,4,6,8,10,13(25),14,16,18,20,22-dodecaen-16-yl)-trimethylsilane |
|---|---|
| PubChem CID | 168733407 |
| Molecular Formula | C32H34NSSi+ |
| Molecular Weight | 492.78 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | (10-tert-butyl-3,24-dimethyl-12-thia-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2,4,6,8,10,13(25),14,16,18,20,22-dodecaen-16-yl)-trimethylsilane |
| SMILES | Cc1c2c(c(C(C)(C)C)c3ccccc13)Sc1cc3c([Si](C)(C)C)cccc3c3cc[n+](C)c-2c13 |
| InChI | InChI=1S/C32H34NSSi/c1-19-20-12-9-10-13-23(20)29(32(2,3)4)31-27(19)30-28-22(16-17-33(30)5)21-14-11-15-26(35(6,7)8)24(21)18-25(28)34-31/h9-18H,1-8H3/q+1 |
| InChIKey | ZDQYIUDNMKMMPK-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.78 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|