C27H27N2O+ — CID 164723218
16-(2,2-dimethylpropyl)-3,21-dimethyl-13-oxa-19-aza-21-azoniahexacyclo[12.7.1.14,8.02,12.018,22.011,23]tricosa-1(21),2,4,6,8(23),11,14,16,18(22),19-decaene (PubChem CID 164723218) has the molecular formula C27H27N2O+ and a molecular weight of 395.53 g/mol. Its IUPAC name is 16-(2,2-dimethylpropyl)-3,21-dimethyl-13-oxa-19-aza-21-azoniahexacyclo[12.7.1.14,8.02,12.018,22.011,23]tricosa-1(21),2,4,6,8(23),11,14,16,18(22),19-decaene.
| Compound Name | 16-(2,2-dimethylpropyl)-3,21-dimethyl-13-oxa-19-aza-21-azoniahexacyclo[12.7.1.14,8.02,12.018,22.011,23]tricosa-1(21),2,4,6,8(23),11,14,16,18(22),19-decaene |
|---|---|
| PubChem CID | 164723218 |
| Molecular Formula | C27H27N2O+ |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 16-(2,2-dimethylpropyl)-3,21-dimethyl-13-oxa-19-aza-21-azoniahexacyclo[12.7.1.14,8.02,12.018,22.011,23]tricosa-1(21),2,4,6,8(23),11,14,16,18(22),19-decaene |
| SMILES | Cc1c2c(c3c4c(cccc14)CC3)Oc1cc(CC(C)(C)C)cc3nc[n+](C)c-2c13 |
| InChI | InChI=1S/C27H27N2O/c1-15-18-8-6-7-17-9-10-19(23(17)18)26-22(15)25-24-20(28-14-29(25)5)11-16(12-21(24)30-26)13-27(2,3)4/h6-8,11-12,14H,9-10,13H2,1-5H3/q+1 |
| InChIKey | DVKMNFDCSPNXCU-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 26.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|