C29H27N2O+ — CID 168733604
17-(2,2-dimethylpropyl)-3,24-dimethyl-12-oxa-22-aza-24-azoniahexacyclo[11.11.1.02,11.04,9.014,19.021,25]pentacosa-1(24),2,4,6,8,10,13,15,17,19,21(25),22-dodecaene (PubChem CID 168733604) has the molecular formula C29H27N2O+ and a molecular weight of 419.55 g/mol. Its IUPAC name is 17-(2,2-dimethylpropyl)-3,24-dimethyl-12-oxa-22-aza-24-azoniahexacyclo[11.11.1.02,11.04,9.014,19.021,25]pentacosa-1(24),2,4,6,8,10,13,15,17,19,21(25),22-dodecaene.
| Compound Name | 17-(2,2-dimethylpropyl)-3,24-dimethyl-12-oxa-22-aza-24-azoniahexacyclo[11.11.1.02,11.04,9.014,19.021,25]pentacosa-1(24),2,4,6,8,10,13,15,17,19,21(25),22-dodecaene |
|---|---|
| PubChem CID | 168733604 |
| Molecular Formula | C29H27N2O+ |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 17-(2,2-dimethylpropyl)-3,24-dimethyl-12-oxa-22-aza-24-azoniahexacyclo[11.11.1.02,11.04,9.014,19.021,25]pentacosa-1(24),2,4,6,8,10,13,15,17,19,21(25),22-dodecaene |
| SMILES | Cc1c2c(cc3ccccc13)Oc1c3ccc(CC(C)(C)C)cc3cc3nc[n+](C)c-2c13 |
| InChI | InChI=1S/C29H27N2O/c1-17-21-9-7-6-8-19(21)14-24-25(17)27-26-23(30-16-31(27)5)13-20-12-18(15-29(2,3)4)10-11-22(20)28(26)32-24/h6-14,16H,15H2,1-5H3/q+1 |
| InChIKey | KILUKGPGDXPPLT-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 26.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|