C19H12N3OS+ — CID 164723343
14-isocyano-3,19-dimethyl-12-oxa-15-thia-17-aza-19-azoniapentacyclo[11.6.1.02,11.04,9.016,20]icosa-1(19),2,4,6,8,10,13,16(20),17-nonaene (PubChem CID 164723343) has the molecular formula C19H12N3OS+ and a molecular weight of 330.39 g/mol. Its IUPAC name is 14-isocyano-3,19-dimethyl-12-oxa-15-thia-17-aza-19-azoniapentacyclo[11.6.1.02,11.04,9.016,20]icosa-1(19),2,4,6,8,10,13,16(20),17-nonaene.
| Compound Name | 14-isocyano-3,19-dimethyl-12-oxa-15-thia-17-aza-19-azoniapentacyclo[11.6.1.02,11.04,9.016,20]icosa-1(19),2,4,6,8,10,13,16(20),17-nonaene |
|---|---|
| PubChem CID | 164723343 |
| Molecular Formula | C19H12N3OS+ |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 14-isocyano-3,19-dimethyl-12-oxa-15-thia-17-aza-19-azoniapentacyclo[11.6.1.02,11.04,9.016,20]icosa-1(19),2,4,6,8,10,13,16(20),17-nonaene |
| SMILES | [C-]#[N+]c1sc2nc[n+](C)c3c2c1Oc1cc2ccccc2c(C)c1-3 |
| InChI | InChI=1S/C19H12N3OS/c1-10-12-7-5-4-6-11(12)8-13-14(10)16-15-17(23-13)19(20-2)24-18(15)21-9-22(16)3/h4-9H,1,3H3/q+1 |
| InChIKey | ILSLRVFRTGEPTJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 30.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|