C22H20N3OS+ — CID 164722409
14-cyclopentyl-3,19-dimethyl-12-oxa-15-thia-8,17-diaza-19-azoniapentacyclo[11.6.1.02,11.04,9.016,20]icosa-1(19),2(11),3,5,7,9,13,16(20),17-nonaene (PubChem CID 164722409) has the molecular formula C22H20N3OS+ and a molecular weight of 374.49 g/mol. Its IUPAC name is 14-cyclopentyl-3,19-dimethyl-12-oxa-15-thia-8,17-diaza-19-azoniapentacyclo[11.6.1.02,11.04,9.016,20]icosa-1(19),2(11),3,5,7,9,13,16(20),17-nonaene.
| Compound Name | 14-cyclopentyl-3,19-dimethyl-12-oxa-15-thia-8,17-diaza-19-azoniapentacyclo[11.6.1.02,11.04,9.016,20]icosa-1(19),2(11),3,5,7,9,13,16(20),17-nonaene |
|---|---|
| PubChem CID | 164722409 |
| Molecular Formula | C22H20N3OS+ |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 14-cyclopentyl-3,19-dimethyl-12-oxa-15-thia-8,17-diaza-19-azoniapentacyclo[11.6.1.02,11.04,9.016,20]icosa-1(19),2(11),3,5,7,9,13,16(20),17-nonaene |
| SMILES | Cc1c2c(cc3ncccc13)Oc1c(C3CCCC3)sc3nc[n+](C)c-2c13 |
| InChI | InChI=1S/C22H20N3OS/c1-12-14-8-5-9-23-15(14)10-16-17(12)19-18-20(26-16)21(13-6-3-4-7-13)27-22(18)24-11-25(19)2/h5,8-11,13H,3-4,6-7H2,1-2H3/q+1 |
| InChIKey | NYZIJGVDTVLRAY-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 38.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|