C26H29N2OS2+ — CID 164722851
13-(4,4-diethylcyclohexyl)-3,18-dimethyl-11-oxa-7,14-dithia-16-aza-18-azoniapentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-1(18),2,4(8),5,9,12,15(19),16-octaene (PubChem CID 164722851) has the molecular formula C26H29N2OS2+ and a molecular weight of 449.67 g/mol. Its IUPAC name is 13-(4,4-diethylcyclohexyl)-3,18-dimethyl-11-oxa-7,14-dithia-16-aza-18-azoniapentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-1(18),2,4(8),5,9,12,15(19),16-octaene.
| Compound Name | 13-(4,4-diethylcyclohexyl)-3,18-dimethyl-11-oxa-7,14-dithia-16-aza-18-azoniapentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-1(18),2,4(8),5,9,12,15(19),16-octaene |
|---|---|
| PubChem CID | 164722851 |
| Molecular Formula | C26H29N2OS2+ |
| Molecular Weight | 449.67 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 13-(4,4-diethylcyclohexyl)-3,18-dimethyl-11-oxa-7,14-dithia-16-aza-18-azoniapentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-1(18),2,4(8),5,9,12,15(19),16-octaene |
| SMILES | CCC1(CC)CCC(c2sc3nc[n+](C)c4c3c2Oc2cc3sccc3c(C)c2-4)CC1 |
| InChI | InChI=1S/C26H29N2OS2/c1-5-26(6-2)10-7-16(8-11-26)24-23-21-22(28(4)14-27-25(21)31-24)20-15(3)17-9-12-30-19(17)13-18(20)29-23/h9,12-14,16H,5-8,10-11H2,1-4H3/q+1 |
| InChIKey | JYTWTLPTEQBIBT-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 26.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.67 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|