C24H25N2OS+ — CID 164722293
14-(2,2-dimethylpropyl)-3,10,19-trimethyl-12-oxa-15-thia-17-aza-19-azoniapentacyclo[11.6.1.02,11.04,9.016,20]icosa-1(19),2,4,6,8,10,13,16(20),17-nonaene (PubChem CID 164722293) has the molecular formula C24H25N2OS+ and a molecular weight of 389.54 g/mol. Its IUPAC name is 14-(2,2-dimethylpropyl)-3,10,19-trimethyl-12-oxa-15-thia-17-aza-19-azoniapentacyclo[11.6.1.02,11.04,9.016,20]icosa-1(19),2,4,6,8,10,13,16(20),17-nonaene.
| Compound Name | 14-(2,2-dimethylpropyl)-3,10,19-trimethyl-12-oxa-15-thia-17-aza-19-azoniapentacyclo[11.6.1.02,11.04,9.016,20]icosa-1(19),2,4,6,8,10,13,16(20),17-nonaene |
|---|---|
| PubChem CID | 164722293 |
| Molecular Formula | C24H25N2OS+ |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 14-(2,2-dimethylpropyl)-3,10,19-trimethyl-12-oxa-15-thia-17-aza-19-azoniapentacyclo[11.6.1.02,11.04,9.016,20]icosa-1(19),2,4,6,8,10,13,16(20),17-nonaene |
| SMILES | Cc1c2c(c(C)c3ccccc13)-c1c3c(c(CC(C)(C)C)sc3nc[n+]1C)O2 |
| InChI | InChI=1S/C24H25N2OS/c1-13-15-9-7-8-10-16(15)14(2)21-18(13)20-19-22(27-21)17(11-24(3,4)5)28-23(19)25-12-26(20)6/h7-10,12H,11H2,1-6H3/q+1 |
| InChIKey | ISQBVAJZMIFNMB-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 26.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|