C23H18N3O+ — CID 164723066
2-(3,10,20-trimethyl-12-oxa-18-aza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaen-15-yl)acetonitrile (PubChem CID 164723066) has the molecular formula C23H18N3O+ and a molecular weight of 352.42 g/mol. Its IUPAC name is 2-(3,10,20-trimethyl-12-oxa-18-aza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaen-15-yl)acetonitrile.
| Compound Name | 2-(3,10,20-trimethyl-12-oxa-18-aza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaen-15-yl)acetonitrile |
|---|---|
| PubChem CID | 164723066 |
| Molecular Formula | C23H18N3O+ |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 2-(3,10,20-trimethyl-12-oxa-18-aza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaen-15-yl)acetonitrile |
| SMILES | Cc1c2c(c(C)c3ccccc13)-c1c3c(cc(CC#N)cc3nc[n+]1C)O2 |
| InChI | InChI=1S/C23H18N3O/c1-13-16-6-4-5-7-17(16)14(2)23-20(13)22-21-18(25-12-26(22)3)10-15(8-9-24)11-19(21)27-23/h4-7,10-12H,8H2,1-3H3/q+1 |
| InChIKey | IEHRLUBKWHMVHS-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 49.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|