C24H21N4+ — CID 164722942
15-(isocyanomethyl)-3,10,12,20-tetramethyl-12,18-diaza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene (PubChem CID 164722942) has the molecular formula C24H21N4+ and a molecular weight of 365.46 g/mol. Its IUPAC name is 15-(isocyanomethyl)-3,10,12,20-tetramethyl-12,18-diaza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene.
| Compound Name | 15-(isocyanomethyl)-3,10,12,20-tetramethyl-12,18-diaza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene |
|---|---|
| PubChem CID | 164722942 |
| Molecular Formula | C24H21N4+ |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 15-(isocyanomethyl)-3,10,12,20-tetramethyl-12,18-diaza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene |
| SMILES | [C-]#[N+]Cc1cc2c3c([n+](C)cnc3c1)-c1c(c(C)c3ccccc3c1C)N2C |
| InChI | InChI=1S/C24H21N4/c1-14-17-8-6-7-9-18(17)15(2)23-21(14)24-22-19(26-13-27(24)4)10-16(12-25-3)11-20(22)28(23)5/h6-11,13H,12H2,1-2,4-5H3/q+1 |
| InChIKey | JZNBPWREIWQAPT-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 24.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|