C26H25N2S+ — CID 164723552
15-(cyclopentylmethyl)-3,20-dimethyl-12-thia-18-aza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene (PubChem CID 164723552) has the molecular formula C26H25N2S+ and a molecular weight of 397.57 g/mol. Its IUPAC name is 15-(cyclopentylmethyl)-3,20-dimethyl-12-thia-18-aza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene.
| Compound Name | 15-(cyclopentylmethyl)-3,20-dimethyl-12-thia-18-aza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene |
|---|---|
| PubChem CID | 164723552 |
| Molecular Formula | C26H25N2S+ |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 15-(cyclopentylmethyl)-3,20-dimethyl-12-thia-18-aza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene |
| SMILES | Cc1c2c(cc3ccccc13)Sc1cc(CC3CCCC3)cc3nc[n+](C)c-2c13 |
| InChI | InChI=1S/C26H25N2S/c1-16-20-10-6-5-9-19(20)14-23-24(16)26-25-21(27-15-28(26)2)12-18(13-22(25)29-23)11-17-7-3-4-8-17/h5-6,9-10,12-15,17H,3-4,7-8,11H2,1-2H3/q+1 |
| InChIKey | VMIUDJRJIYPVKN-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|