C26H24N3S+ — CID 164722258
15-(2-isocyano-2-methylpropyl)-3,10,20-trimethyl-12-thia-18-aza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene (PubChem CID 164722258) has the molecular formula C26H24N3S+ and a molecular weight of 410.57 g/mol. Its IUPAC name is 15-(2-isocyano-2-methylpropyl)-3,10,20-trimethyl-12-thia-18-aza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene.
| Compound Name | 15-(2-isocyano-2-methylpropyl)-3,10,20-trimethyl-12-thia-18-aza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene |
|---|---|
| PubChem CID | 164722258 |
| Molecular Formula | C26H24N3S+ |
| Molecular Weight | 410.57 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 15-(2-isocyano-2-methylpropyl)-3,10,20-trimethyl-12-thia-18-aza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene |
| SMILES | [C-]#[N+]C(C)(C)Cc1cc2c3c([n+](C)cnc3c1)-c1c(c(C)c3ccccc3c1C)S2 |
| InChI | InChI=1S/C26H24N3S/c1-15-18-9-7-8-10-19(18)16(2)25-22(15)24-23-20(28-14-29(24)6)11-17(12-21(23)30-25)13-26(3,4)27-5/h7-12,14H,13H2,1-4,6H3/q+1 |
| InChIKey | OIWRBZJUKKVJAV-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 21.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.57 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|