C30H31N2O+ — CID 164722517
15-(2-isocyano-2-methylpropyl)-3,20-dimethyl-10-(2-methylpropyl)-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaene (PubChem CID 164722517) has the molecular formula C30H31N2O+ and a molecular weight of 435.59 g/mol. Its IUPAC name is 15-(2-isocyano-2-methylpropyl)-3,20-dimethyl-10-(2-methylpropyl)-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaene.
| Compound Name | 15-(2-isocyano-2-methylpropyl)-3,20-dimethyl-10-(2-methylpropyl)-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaene |
|---|---|
| PubChem CID | 164722517 |
| Molecular Formula | C30H31N2O+ |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | 15-(2-isocyano-2-methylpropyl)-3,20-dimethyl-10-(2-methylpropyl)-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaene |
| SMILES | [C-]#[N+]C(C)(C)Cc1cc2c3c([n+](C)ccc3c1)-c1c(c(CC(C)C)c3ccccc3c1C)O2 |
| InChI | InChI=1S/C30H31N2O/c1-18(2)14-24-23-11-9-8-10-22(23)19(3)26-28-27-21(12-13-32(28)7)15-20(17-30(4,5)31-6)16-25(27)33-29(24)26/h8-13,15-16,18H,14,17H2,1-5,7H3/q+1 |
| InChIKey | QUWVNBFAFUHQCY-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 17.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|