C30H33N2OSi+ — CID 164723474
[15-(2-isocyano-2-methylpropyl)-3,10,20-trimethyl-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2(11),3,5,7,9,13(21),14,16,18-decaen-7-yl]-trimethylsilane (PubChem CID 164723474) has the molecular formula C30H33N2OSi+ and a molecular weight of 465.69 g/mol. Its IUPAC name is [15-(2-isocyano-2-methylpropyl)-3,10,20-trimethyl-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2(11),3,5,7,9,13(21),14,16,18-decaen-7-yl]-trimethylsilane.
| Compound Name | [15-(2-isocyano-2-methylpropyl)-3,10,20-trimethyl-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2(11),3,5,7,9,13(21),14,16,18-decaen-7-yl]-trimethylsilane |
|---|---|
| PubChem CID | 164723474 |
| Molecular Formula | C30H33N2OSi+ |
| Molecular Weight | 465.69 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | [15-(2-isocyano-2-methylpropyl)-3,10,20-trimethyl-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2(11),3,5,7,9,13(21),14,16,18-decaen-7-yl]-trimethylsilane |
| SMILES | [C-]#[N+]C(C)(C)Cc1cc2c3c([n+](C)ccc3c1)-c1c(c(C)c3cc([Si](C)(C)C)ccc3c1C)O2 |
| InChI | InChI=1S/C30H33N2OSi/c1-18-23-11-10-22(34(7,8)9)16-24(23)19(2)29-26(18)28-27-21(12-13-32(28)6)14-20(15-25(27)33-29)17-30(3,4)31-5/h10-16H,17H2,1-4,6-9H3/q+1 |
| InChIKey | GFOFQHZXZWJXEC-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 17.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.69 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|