C24H21N2O2+ — CID 164722371
14-(2-isocyano-2-methylpropyl)-3,19-dimethyl-5,11-dioxa-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),3,6,8,12(20),13,15,17-nonaene (PubChem CID 164722371) has the molecular formula C24H21N2O2+ and a molecular weight of 369.44 g/mol. Its IUPAC name is 14-(2-isocyano-2-methylpropyl)-3,19-dimethyl-5,11-dioxa-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),3,6,8,12(20),13,15,17-nonaene.
| Compound Name | 14-(2-isocyano-2-methylpropyl)-3,19-dimethyl-5,11-dioxa-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),3,6,8,12(20),13,15,17-nonaene |
|---|---|
| PubChem CID | 164722371 |
| Molecular Formula | C24H21N2O2+ |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 14-(2-isocyano-2-methylpropyl)-3,19-dimethyl-5,11-dioxa-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),3,6,8,12(20),13,15,17-nonaene |
| SMILES | [C-]#[N+]C(C)(C)Cc1cc2c3c([n+](C)ccc3c1)-c1c(cc3ccoc3c1C)O2 |
| InChI | InChI=1S/C24H21N2O2/c1-14-20-19(12-17-7-9-27-23(14)17)28-18-11-15(13-24(2,3)25-4)10-16-6-8-26(5)22(20)21(16)18/h6-12H,13H2,1-3,5H3/q+1 |
| InChIKey | VXSSBADYFHMZQU-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 30.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|