C22H22NO2Si+ — CID 164722859
(3,19-dimethyl-5,11-dioxa-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),3,6,8,12(20),13,15,17-nonaen-14-yl)-trimethylsilane (PubChem CID 164722859) has the molecular formula C22H22NO2Si+ and a molecular weight of 360.51 g/mol. Its IUPAC name is (3,19-dimethyl-5,11-dioxa-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),3,6,8,12(20),13,15,17-nonaen-14-yl)-trimethylsilane.
| Compound Name | (3,19-dimethyl-5,11-dioxa-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),3,6,8,12(20),13,15,17-nonaen-14-yl)-trimethylsilane |
|---|---|
| PubChem CID | 164722859 |
| Molecular Formula | C22H22NO2Si+ |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | (3,19-dimethyl-5,11-dioxa-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),3,6,8,12(20),13,15,17-nonaen-14-yl)-trimethylsilane |
| SMILES | Cc1c2c(cc3ccoc13)Oc1cc([Si](C)(C)C)cc3cc[n+](C)c-2c13 |
| InChI | InChI=1S/C22H22NO2Si/c1-13-19-17(11-15-7-9-24-22(13)15)25-18-12-16(26(3,4)5)10-14-6-8-23(2)21(19)20(14)18/h6-12H,1-5H3/q+1 |
| InChIKey | VCLZMWHAOBZPDY-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 26.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|